About 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide
3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 42758408) has the molecular formula C20H20N4O4
and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide |
| PubChem CID | 42758408 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | CCONC(=O)c1cc(-c2ccc(C)c(C)c2)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20N4O4/c1-4-28-22-20(25)19-12-18(15-6-5-13(2)14(3)11-15)21-23(19)16-7-9-17(10-8-16)24(26)27/h5-12H,4H2,1-3H3,(H,22,25) |
| InChIKey | HRKOCCNVKCMHMK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide?
The IUPAC name of 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide (CID 42758408) is 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide.
What is the SMILES notation for 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide?
The canonical SMILES for 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide is CCONC(=O)c1cc(-c2ccc(C)c(C)c2)nn1-c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide?
The InChIKey is HRKOCCNVKCMHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O4/c1-4-28-22-20(25)19-12-18(15-6-5-13(2)14(3)11-15)21-23(19)16-7-9-17(10-8-16)24(26)27/h5-12H,4H2,1-3H3,(H,22,25).
What are the key properties of 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide?
3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide has a molecular weight of 380.40 g/mol, XLogP of 3.75, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)-N-ethoxy-1-(4-nitrophenyl)pyrazole-5-carboxamide is sourced from PubChem (CID 42758408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).