C23H24N4O3 — CID 5030798
[3-(3,4-dimethylphenyl)-1-(4-nitrophenyl)pyrazol-5-yl]-piperidin-1-ylmethanone (PubChem CID 5030798) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)-1-(4-nitrophenyl)pyrazol-5-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-(3,4-dimethylphenyl)-1-(4-nitrophenyl)pyrazol-5-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 5030798 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [3-(3,4-dimethylphenyl)-1-(4-nitrophenyl)pyrazol-5-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCCCC3)n(-c3ccc([N+](=O)[O-])cc3)n2)cc1C |
| InChI | InChI=1S/C23H24N4O3/c1-16-6-7-18(14-17(16)2)21-15-22(23(28)25-12-4-3-5-13-25)26(24-21)19-8-10-20(11-9-19)27(29)30/h6-11,14-15H,3-5,12-13H2,1-2H3 |
| InChIKey | GRXXVXBAHQNBJU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|