C27H24FN5O4 — CID 42762222
[1-(4-fluorophenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 42762222) has the molecular formula C27H24FN5O4 and a molecular weight of 501.52 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(4-fluorophenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42762222 |
| Molecular Formula | C27H24FN5O4 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | [1-(4-fluorophenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2cc(-c3ccc([N+](=O)[O-])cc3)nn2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H24FN5O4/c1-37-26-5-3-2-4-24(26)30-14-16-31(17-15-30)27(34)25-18-23(19-6-10-22(11-7-19)33(35)36)29-32(25)21-12-8-20(28)9-13-21/h2-13,18H,14-17H2,1H3 |
| InChIKey | KFILIRPXAPOQHO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|