C26H21ClFN5O3 — CID 1053641
[1-(2-chlorophenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 1053641) has the molecular formula C26H21ClFN5O3 and a molecular weight of 505.94 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(2-chlorophenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 1053641 |
| Molecular Formula | C26H21ClFN5O3 |
| Molecular Weight | 505.94 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | [1-(2-chlorophenyl)-3-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc([N+](=O)[O-])cc2)nn1-c1ccccc1Cl)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H21ClFN5O3/c27-20-5-1-3-7-23(20)32-25(17-22(29-32)18-9-11-19(12-10-18)33(35)36)26(34)31-15-13-30(14-16-31)24-8-4-2-6-21(24)28/h1-12,17H,13-16H2 |
| InChIKey | KCIFDPXTGNVCTM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|