C28H26ClN5O5 — CID 42759039
[1-(2-chlorophenyl)-3-(2,4-dimethoxyphenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 42759039) has the molecular formula C28H26ClN5O5 and a molecular weight of 548.00 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-3-(2,4-dimethoxyphenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(2-chlorophenyl)-3-(2,4-dimethoxyphenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42759039 |
| Molecular Formula | C28H26ClN5O5 |
| Molecular Weight | 548.00 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | [1-(2-chlorophenyl)-3-(2,4-dimethoxyphenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)n(-c3ccccc3Cl)n2)c(OC)c1 |
| InChI | InChI=1S/C28H26ClN5O5/c1-38-21-11-12-22(27(17-21)39-2)24-18-26(33(30-24)25-6-4-3-5-23(25)29)28(35)32-15-13-31(14-16-32)19-7-9-20(10-8-19)34(36)37/h3-12,17-18H,13-16H2,1-2H3 |
| InChIKey | VGSIXPKGLBZGHA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 102.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.00 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|