C26H22ClN5O3 — CID 42759317
[3-(2-chlorophenyl)-1-phenylpyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 42759317) has the molecular formula C26H22ClN5O3 and a molecular weight of 487.95 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-1-phenylpyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(2-chlorophenyl)-1-phenylpyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42759317 |
| Molecular Formula | C26H22ClN5O3 |
| Molecular Weight | 487.95 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [3-(2-chlorophenyl)-1-phenylpyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccccc2Cl)nn1-c1ccccc1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H22ClN5O3/c27-23-9-5-4-8-22(23)24-18-25(31(28-24)20-6-2-1-3-7-20)26(33)30-16-14-29(15-17-30)19-10-12-21(13-11-19)32(34)35/h1-13,18H,14-17H2 |
| InChIKey | JIZZLZLUWRVSEO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.95 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|