C27H24Cl2N4O2 — CID 42662575
[3-(2-chlorophenyl)-1-(3-chlorophenyl)pyrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 42662575) has the molecular formula C27H24Cl2N4O2 and a molecular weight of 507.42 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-1-(3-chlorophenyl)pyrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(2-chlorophenyl)-1-(3-chlorophenyl)pyrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42662575 |
| Molecular Formula | C27H24Cl2N4O2 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | [3-(2-chlorophenyl)-1-(3-chlorophenyl)pyrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(-c4ccccc4Cl)nn3-c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C27H24Cl2N4O2/c1-35-22-11-9-20(10-12-22)31-13-15-32(16-14-31)27(34)26-18-25(23-7-2-3-8-24(23)29)30-33(26)21-6-4-5-19(28)17-21/h2-12,17-18H,13-16H2,1H3 |
| InChIKey | GHZJHSZPYVETOO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|