C24H20N6O6 — CID 4266210
[3-(furan-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 4266210) has the molecular formula C24H20N6O6 and a molecular weight of 488.46 g/mol. Its IUPAC name is [3-(furan-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(furan-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4266210 |
| Molecular Formula | C24H20N6O6 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [3-(furan-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccco2)nn1-c1cccc([N+](=O)[O-])c1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C24H20N6O6/c31-24(27-12-10-26(11-13-27)17-6-8-18(9-7-17)29(32)33)22-16-21(23-5-2-14-36-23)25-28(22)19-3-1-4-20(15-19)30(34)35/h1-9,14-16H,10-13H2 |
| InChIKey | MUOJSPSIXZKGQM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 140.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|