C25H22Cl2N6O3 — CID 3640244
[1-(3,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 3640244) has the molecular formula C25H22Cl2N6O3 and a molecular weight of 525.40 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(3,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3640244 |
| Molecular Formula | C25H22Cl2N6O3 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cn1cccc1-c1cc(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C25H22Cl2N6O3/c1-29-10-2-3-23(29)22-16-24(32(28-22)19-8-9-20(26)21(27)15-19)25(34)31-13-11-30(12-14-31)17-4-6-18(7-5-17)33(35)36/h2-10,15-16H,11-14H2,1H3 |
| InChIKey | BEBVMFCXSLEMGD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 89.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|