C21H22N6O4 — CID 3423793
1-[3-(1-methylpyrrol-2-yl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidine-4-carboxamide (PubChem CID 3423793) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is 1-[3-(1-methylpyrrol-2-yl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-(1-methylpyrrol-2-yl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3423793 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-[3-(1-methylpyrrol-2-yl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidine-4-carboxamide |
| SMILES | Cn1cccc1-c1cc(C(=O)N2CCC(C(N)=O)CC2)n(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C21H22N6O4/c1-24-9-3-6-18(24)17-13-19(21(29)25-10-7-14(8-11-25)20(22)28)26(23-17)15-4-2-5-16(12-15)27(30)31/h2-6,9,12-14H,7-8,10-11H2,1H3,(H2,22,28) |
| InChIKey | QPNFEVFNJAIDQA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|