C25H26N4O6 — CID 4008409
ethyl 1-[3-(4-methoxyphenyl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidine-4-carboxylate (PubChem CID 4008409) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is ethyl 1-[3-(4-methoxyphenyl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(4-methoxyphenyl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4008409 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | ethyl 1-[3-(4-methoxyphenyl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc(-c3ccc(OC)cc3)nn2-c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C25H26N4O6/c1-3-35-25(31)18-11-13-27(14-12-18)24(30)23-16-22(17-7-9-21(34-2)10-8-17)26-28(23)19-5-4-6-20(15-19)29(32)33/h4-10,15-16,18H,3,11-14H2,1-2H3 |
| InChIKey | JYHWFLIHWMKGNO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 116.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|