C22H22FN5O3 — CID 42758535
(4-ethylpiperazin-1-yl)-[3-(4-fluorophenyl)-1-(3-nitrophenyl)pyrazol-5-yl]methanone (PubChem CID 42758535) has the molecular formula C22H22FN5O3 and a molecular weight of 423.45 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[3-(4-fluorophenyl)-1-(3-nitrophenyl)pyrazol-5-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[3-(4-fluorophenyl)-1-(3-nitrophenyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 42758535 |
| Molecular Formula | C22H22FN5O3 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[3-(4-fluorophenyl)-1-(3-nitrophenyl)pyrazol-5-yl]methanone |
| SMILES | CCN1CCN(C(=O)c2cc(-c3ccc(F)cc3)nn2-c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H22FN5O3/c1-2-25-10-12-26(13-11-25)22(29)21-15-20(16-6-8-17(23)9-7-16)24-27(21)18-4-3-5-19(14-18)28(30)31/h3-9,14-15H,2,10-13H2,1H3 |
| InChIKey | FDFQLWCIBGFEOS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|