C20H21N5O4 — CID 1053696
(4-ethylpiperazin-1-yl)-[3-(furan-2-yl)-1-(4-nitrophenyl)pyrazol-5-yl]methanone (PubChem CID 1053696) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[3-(furan-2-yl)-1-(4-nitrophenyl)pyrazol-5-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[3-(furan-2-yl)-1-(4-nitrophenyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 1053696 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[3-(furan-2-yl)-1-(4-nitrophenyl)pyrazol-5-yl]methanone |
| SMILES | CCN1CCN(C(=O)c2cc(-c3ccco3)nn2-c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H21N5O4/c1-2-22-9-11-23(12-10-22)20(26)18-14-17(19-4-3-13-29-19)21-24(18)15-5-7-16(8-6-15)25(27)28/h3-8,13-14H,2,9-12H2,1H3 |
| InChIKey | ZNSPFAVGXHNECU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|