C22H20N6O2 — CID 42159681
[3-(furan-2-yl)-1-phenylpyrazol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 42159681) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is [3-(furan-2-yl)-1-phenylpyrazol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [3-(furan-2-yl)-1-phenylpyrazol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 42159681 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [3-(furan-2-yl)-1-phenylpyrazol-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cc(-c2ccco2)nn1-c1ccccc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H20N6O2/c29-21(26-11-13-27(14-12-26)22-23-9-5-10-24-22)19-16-18(20-8-4-15-30-20)25-28(19)17-6-2-1-3-7-17/h1-10,15-16H,11-14H2 |
| InChIKey | BUOARNYFEUTDTN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |