C26H23N3O3 — CID 24682960
[1-[3-(furan-2-yl)-1-phenylpyrazole-5-carbonyl]piperidin-4-yl]-phenylmethanone (PubChem CID 24682960) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is [1-[3-(furan-2-yl)-1-phenylpyrazole-5-carbonyl]piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-[3-(furan-2-yl)-1-phenylpyrazole-5-carbonyl]piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 24682960 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [1-[3-(furan-2-yl)-1-phenylpyrazole-5-carbonyl]piperidin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCN(C(=O)c2cc(-c3ccco3)nn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H23N3O3/c30-25(19-8-3-1-4-9-19)20-13-15-28(16-14-20)26(31)23-18-22(24-12-7-17-32-24)27-29(23)21-10-5-2-6-11-21/h1-12,17-18,20H,13-16H2 |
| InChIKey | NITOKEGOMKGMMN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |