C25H24N4O4S — CID 41470718
N-[1-[3-(furan-2-yl)-1-phenylpyrazole-5-carbonyl]piperidin-4-yl]benzenesulfonamide (PubChem CID 41470718) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[1-[3-(furan-2-yl)-1-phenylpyrazole-5-carbonyl]piperidin-4-yl]benzenesulfonamide.
| Compound Name | N-[1-[3-(furan-2-yl)-1-phenylpyrazole-5-carbonyl]piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 41470718 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[1-[3-(furan-2-yl)-1-phenylpyrazole-5-carbonyl]piperidin-4-yl]benzenesulfonamide |
| SMILES | O=C(c1cc(-c2ccco2)nn1-c1ccccc1)N1CCC(NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H24N4O4S/c30-25(28-15-13-19(14-16-28)27-34(31,32)21-10-5-2-6-11-21)23-18-22(24-12-7-17-33-24)26-29(23)20-8-3-1-4-9-20/h1-12,17-19,27H,13-16H2 |
| InChIKey | RCVLGCBTNIBIRF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |