C26H25N3O3 — CID 55489912
[3-(furan-2-yl)-1-phenylpyrazol-5-yl]-(4-phenylmethoxypiperidin-1-yl)methanone (PubChem CID 55489912) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is [3-(furan-2-yl)-1-phenylpyrazol-5-yl]-(4-phenylmethoxypiperidin-1-yl)methanone.
| Compound Name | [3-(furan-2-yl)-1-phenylpyrazol-5-yl]-(4-phenylmethoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 55489912 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [3-(furan-2-yl)-1-phenylpyrazol-5-yl]-(4-phenylmethoxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(-c2ccco2)nn1-c1ccccc1)N1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H25N3O3/c30-26(28-15-13-22(14-16-28)32-19-20-8-3-1-4-9-20)24-18-23(25-12-7-17-31-25)27-29(24)21-10-5-2-6-11-21/h1-12,17-18,22H,13-16,19H2 |
| InChIKey | CAIFWRLIASBJFN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |