C24H25N5O6 — CID 4642190
ethyl 4-[3-(3-methoxyphenyl)-1-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate (PubChem CID 4642190) has the molecular formula C24H25N5O6 and a molecular weight of 479.49 g/mol. Its IUPAC name is ethyl 4-[3-(3-methoxyphenyl)-1-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(3-methoxyphenyl)-1-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 4642190 |
| Molecular Formula | C24H25N5O6 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | ethyl 4-[3-(3-methoxyphenyl)-1-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(-c3cccc(OC)c3)nn2-c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C24H25N5O6/c1-3-35-24(31)27-13-11-26(12-14-27)23(30)22-16-21(17-5-4-6-20(15-17)34-2)25-28(22)18-7-9-19(10-8-18)29(32)33/h4-10,15-16H,3,11-14H2,1-2H3 |
| InChIKey | HRUAXMRRGYJMSD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 120.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|