C30H31N5O6 — CID 3602168
[3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone (PubChem CID 3602168) has the molecular formula C30H31N5O6 and a molecular weight of 557.61 g/mol. Its IUPAC name is [3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3602168 |
| Molecular Formula | C30H31N5O6 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | [3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)pyrazol-5-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCOc1ccccc1N1CCN(C(=O)c2cc(-c3ccc(OC)cc3OC)nn2-c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C30H31N5O6/c1-4-41-28-8-6-5-7-26(28)32-15-17-33(18-16-32)30(36)27-20-25(24-14-13-23(39-2)19-29(24)40-3)31-34(27)21-9-11-22(12-10-21)35(37)38/h5-14,19-20H,4,15-18H2,1-3H3 |
| InChIKey | LIVMKOUDTKZSRD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 112.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|