C29H30N4O2 — CID 3651185
[4-(2-ethoxyphenyl)piperazin-1-yl]-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]methanone (PubChem CID 3651185) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]methanone.
| Compound Name | [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 3651185 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [4-(2-ethoxyphenyl)piperazin-1-yl]-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]methanone |
| SMILES | CCOc1ccccc1N1CCN(C(=O)c2cc(-c3ccccc3)nn2-c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C29H30N4O2/c1-3-35-28-12-8-7-11-26(28)31-17-19-32(20-18-31)29(34)27-21-25(23-9-5-4-6-10-23)30-33(27)24-15-13-22(2)14-16-24/h4-16,21H,3,17-20H2,1-2H3 |
| InChIKey | PWHDSKLSXGXQDP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |