C30H31N5O4 — CID 3635138
[3-(3,4-dimethylphenyl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone (PubChem CID 3635138) has the molecular formula C30H31N5O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(3,4-dimethylphenyl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3635138 |
| Molecular Formula | C30H31N5O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | [3-(3,4-dimethylphenyl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(2-ethoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCOc1ccccc1N1CCN(C(=O)c2cc(-c3ccc(C)c(C)c3)nn2-c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C30H31N5O4/c1-4-39-29-11-6-5-10-27(29)32-14-16-33(17-15-32)30(36)28-20-26(23-13-12-21(2)22(3)18-23)31-34(28)24-8-7-9-25(19-24)35(37)38/h5-13,18-20H,4,14-17H2,1-3H3 |
| InChIKey | QYZDHZFHBPHEAE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|