C26H25N5O4 — CID 3907303
[3-(5-methylfuran-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(2-methylphenyl)piperazin-1-yl]methanone (PubChem CID 3907303) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is [3-(5-methylfuran-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(2-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(5-methylfuran-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(2-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3907303 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [3-(5-methylfuran-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-(2-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCN(c4ccccc4C)CC3)n(-c3cccc([N+](=O)[O-])c3)n2)o1 |
| InChI | InChI=1S/C26H25N5O4/c1-18-6-3-4-9-23(18)28-12-14-29(15-13-28)26(32)24-17-22(25-11-10-19(2)35-25)27-30(24)20-7-5-8-21(16-20)31(33)34/h3-11,16-17H,12-15H2,1-2H3 |
| InChIKey | SHMGKAHJACEVTN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 97.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|