C26H27N5O — CID 3510138
[4-(2-methylphenyl)piperazin-1-yl]-[3-(1-methylpyrrol-2-yl)-1-phenylpyrazol-5-yl]methanone (PubChem CID 3510138) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is [4-(2-methylphenyl)piperazin-1-yl]-[3-(1-methylpyrrol-2-yl)-1-phenylpyrazol-5-yl]methanone.
| Compound Name | [4-(2-methylphenyl)piperazin-1-yl]-[3-(1-methylpyrrol-2-yl)-1-phenylpyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 3510138 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [4-(2-methylphenyl)piperazin-1-yl]-[3-(1-methylpyrrol-2-yl)-1-phenylpyrazol-5-yl]methanone |
| SMILES | Cc1ccccc1N1CCN(C(=O)c2cc(-c3cccn3C)nn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27N5O/c1-20-9-6-7-12-23(20)29-15-17-30(18-16-29)26(32)25-19-22(24-13-8-14-28(24)2)27-31(25)21-10-4-3-5-11-21/h3-14,19H,15-18H2,1-2H3 |
| InChIKey | JNFBYBAUMNNCMX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |