C26H22F3N5O4 — CID 4234200
[3-(5-methylfuran-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 4234200) has the molecular formula C26H22F3N5O4 and a molecular weight of 525.49 g/mol. Its IUPAC name is [3-(5-methylfuran-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [3-(5-methylfuran-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4234200 |
| Molecular Formula | C26H22F3N5O4 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | [3-(5-methylfuran-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCN(c4cccc(C(F)(F)F)c4)CC3)n(-c3cccc([N+](=O)[O-])c3)n2)o1 |
| InChI | InChI=1S/C26H22F3N5O4/c1-17-8-9-24(38-17)22-16-23(33(30-22)20-6-3-7-21(15-20)34(36)37)25(35)32-12-10-31(11-13-32)19-5-2-4-18(14-19)26(27,28)29/h2-9,14-16H,10-13H2,1H3 |
| InChIKey | NHFWUQPNUVMFLU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 97.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|