C26H23N5O6 — CID 1053929
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[3-(furan-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]methanone (PubChem CID 1053929) has the molecular formula C26H23N5O6 and a molecular weight of 501.50 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[3-(furan-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[3-(furan-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 1053929 |
| Molecular Formula | C26H23N5O6 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[3-(furan-2-yl)-1-(3-nitrophenyl)pyrazol-5-yl]methanone |
| SMILES | O=C(c1cc(-c2ccco2)nn1-c1cccc([N+](=O)[O-])c1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C26H23N5O6/c32-26(29-10-8-28(9-11-29)16-18-6-7-24-25(13-18)37-17-36-24)22-15-21(23-5-2-12-35-23)27-30(22)19-3-1-4-20(14-19)31(33)34/h1-7,12-15H,8-11,16-17H2 |
| InChIKey | LTVIWVAHQHRICT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 116.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|