C26H21F2N5O3 — CID 3687460
[3-(2-fluorophenyl)-1-(4-fluorophenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 3687460) has the molecular formula C26H21F2N5O3 and a molecular weight of 489.48 g/mol. Its IUPAC name is [3-(2-fluorophenyl)-1-(4-fluorophenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(2-fluorophenyl)-1-(4-fluorophenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3687460 |
| Molecular Formula | C26H21F2N5O3 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [3-(2-fluorophenyl)-1-(4-fluorophenyl)pyrazol-5-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccccc2F)nn1-c1ccc(F)cc1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H21F2N5O3/c27-18-5-7-20(8-6-18)32-25(17-24(29-32)22-3-1-2-4-23(22)28)26(34)31-15-13-30(14-16-31)19-9-11-21(12-10-19)33(35)36/h1-12,17H,13-16H2 |
| InChIKey | SGCUVVCHFQZHTB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|