C24H21N5O3 — CID 3958363
3-(3,4-dimethylphenyl)-1-(4-nitrophenyl)-N-(pyridin-4-ylmethyl)pyrazole-5-carboxamide (PubChem CID 3958363) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-(4-nitrophenyl)-N-(pyridin-4-ylmethyl)pyrazole-5-carboxamide.
| Compound Name | 3-(3,4-dimethylphenyl)-1-(4-nitrophenyl)-N-(pyridin-4-ylmethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3958363 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-(4-nitrophenyl)-N-(pyridin-4-ylmethyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCc3ccncc3)n(-c3ccc([N+](=O)[O-])cc3)n2)cc1C |
| InChI | InChI=1S/C24H21N5O3/c1-16-3-4-19(13-17(16)2)22-14-23(24(30)26-15-18-9-11-25-12-10-18)28(27-22)20-5-7-21(8-6-20)29(31)32/h3-14H,15H2,1-2H3,(H,26,30) |
| InChIKey | TTYPNUINAFCVJL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|