C25H22N4O5 — CID 3332427
N-benzyl-3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 3332427) has the molecular formula C25H22N4O5 and a molecular weight of 458.47 g/mol. Its IUPAC name is N-benzyl-3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | N-benzyl-3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3332427 |
| Molecular Formula | C25H22N4O5 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-benzyl-3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCc3ccccc3)n(-c3ccc([N+](=O)[O-])cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C25H22N4O5/c1-33-20-12-13-21(24(14-20)34-2)22-15-23(25(30)26-16-17-6-4-3-5-7-17)28(27-22)18-8-10-19(11-9-18)29(31)32/h3-15H,16H2,1-2H3,(H,26,30) |
| InChIKey | DQBXPBQUTCOAER-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|