C25H23N5O5 — CID 42762020
3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)-N-(2-pyridin-2-ylethyl)pyrazole-5-carboxamide (PubChem CID 42762020) has the molecular formula C25H23N5O5 and a molecular weight of 473.49 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)-N-(2-pyridin-2-ylethyl)pyrazole-5-carboxamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)-N-(2-pyridin-2-ylethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42762020 |
| Molecular Formula | C25H23N5O5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-(4-nitrophenyl)-N-(2-pyridin-2-ylethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCc3ccccn3)n(-c3ccc([N+](=O)[O-])cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C25H23N5O5/c1-34-20-10-11-21(24(15-20)35-2)22-16-23(25(31)27-14-12-17-5-3-4-13-26-17)29(28-22)18-6-8-19(9-7-18)30(32)33/h3-11,13,15-16H,12,14H2,1-2H3,(H,27,31) |
| InChIKey | XPUMDOIWBLPZBM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|