C25H21FN4O3 — CID 42758410
3-(3,4-dimethylphenyl)-N-[(4-fluorophenyl)methyl]-1-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 42758410) has the molecular formula C25H21FN4O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-[(4-fluorophenyl)methyl]-1-(4-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-[(4-fluorophenyl)methyl]-1-(4-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42758410 |
| Molecular Formula | C25H21FN4O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-[(4-fluorophenyl)methyl]-1-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCc3ccc(F)cc3)n(-c3ccc([N+](=O)[O-])cc3)n2)cc1C |
| InChI | InChI=1S/C25H21FN4O3/c1-16-3-6-19(13-17(16)2)23-14-24(25(31)27-15-18-4-7-20(26)8-5-18)29(28-23)21-9-11-22(12-10-21)30(32)33/h3-14H,15H2,1-2H3,(H,27,31) |
| InChIKey | FMNWRAAINPSDFU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|