C22H24N4O3 — CID 3989832
3-(3,4-dimethylphenyl)-N-(2-methylpropyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 3989832) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-(2-methylpropyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-(2-methylpropyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3989832 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-(2-methylpropyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCC(C)C)n(-c3ccc([N+](=O)[O-])cc3)n2)cc1C |
| InChI | InChI=1S/C22H24N4O3/c1-14(2)13-23-22(27)21-12-20(17-6-5-15(3)16(4)11-17)24-25(21)18-7-9-19(10-8-18)26(28)29/h5-12,14H,13H2,1-4H3,(H,23,27) |
| InChIKey | CUJJRBCVRDNLBK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|