C32H29N3O3 — CID 4693927
3-(2,4-dimethoxyphenyl)-N-(1,2-diphenylethyl)-1-phenylpyrazole-5-carboxamide (PubChem CID 4693927) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-N-(1,2-diphenylethyl)-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-N-(1,2-diphenylethyl)-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4693927 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-N-(1,2-diphenylethyl)-1-phenylpyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NC(Cc3ccccc3)c3ccccc3)n(-c3ccccc3)n2)c(OC)c1 |
| InChI | InChI=1S/C32H29N3O3/c1-37-26-18-19-27(31(21-26)38-2)29-22-30(35(34-29)25-16-10-5-11-17-25)32(36)33-28(24-14-8-4-9-15-24)20-23-12-6-3-7-13-23/h3-19,21-22,28H,20H2,1-2H3,(H,33,36) |
| InChIKey | XGYWGHZRHIXPPV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |