C22H22FN5O3 — CID 4310575
3-(2-fluorophenyl)-1-(3-nitrophenyl)-N-(2-pyrrolidin-1-ylethyl)pyrazole-5-carboxamide (PubChem CID 4310575) has the molecular formula C22H22FN5O3 and a molecular weight of 423.45 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-(3-nitrophenyl)-N-(2-pyrrolidin-1-ylethyl)pyrazole-5-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-1-(3-nitrophenyl)-N-(2-pyrrolidin-1-ylethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4310575 |
| Molecular Formula | C22H22FN5O3 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-(2-fluorophenyl)-1-(3-nitrophenyl)-N-(2-pyrrolidin-1-ylethyl)pyrazole-5-carboxamide |
| SMILES | O=C(NCCN1CCCC1)c1cc(-c2ccccc2F)nn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22FN5O3/c23-19-9-2-1-8-18(19)20-15-21(22(29)24-10-13-26-11-3-4-12-26)27(25-20)16-6-5-7-17(14-16)28(30)31/h1-2,5-9,14-15H,3-4,10-13H2,(H,24,29) |
| InChIKey | KLTXMKGASYAFPA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|