C31H25FN4O3 — CID 3938929
N-benzyl-3-(2-fluorophenyl)-1-(3-nitrophenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide (PubChem CID 3938929) has the molecular formula C31H25FN4O3 and a molecular weight of 520.56 g/mol. Its IUPAC name is N-benzyl-3-(2-fluorophenyl)-1-(3-nitrophenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide.
| Compound Name | N-benzyl-3-(2-fluorophenyl)-1-(3-nitrophenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3938929 |
| Molecular Formula | C31H25FN4O3 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-benzyl-3-(2-fluorophenyl)-1-(3-nitrophenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide |
| SMILES | O=C(c1cc(-c2ccccc2F)nn1-c1cccc([N+](=O)[O-])c1)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H25FN4O3/c32-28-17-8-7-16-27(28)29-21-30(35(33-29)25-14-9-15-26(20-25)36(38)39)31(37)34(22-24-12-5-2-6-13-24)19-18-23-10-3-1-4-11-23/h1-17,20-21H,18-19,22H2 |
| InChIKey | IJWHMMBYTCARTA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|