C29H24N4O4 — CID 1053910
N-benzyl-3-(furan-2-yl)-1-(3-nitrophenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide (PubChem CID 1053910) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-benzyl-3-(furan-2-yl)-1-(3-nitrophenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide.
| Compound Name | N-benzyl-3-(furan-2-yl)-1-(3-nitrophenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 1053910 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-benzyl-3-(furan-2-yl)-1-(3-nitrophenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide |
| SMILES | O=C(c1cc(-c2ccco2)nn1-c1cccc([N+](=O)[O-])c1)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H24N4O4/c34-29(31(21-23-11-5-2-6-12-23)17-16-22-9-3-1-4-10-22)27-20-26(28-15-8-18-37-28)30-32(27)24-13-7-14-25(19-24)33(35)36/h1-15,18-20H,16-17,21H2 |
| InChIKey | OFABJDQEFXQUDB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 94.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|