C20H22N5O5+ — CID 6961782
3-(furan-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 6961782) has the molecular formula C20H22N5O5+ and a molecular weight of 412.43 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | 3-(furan-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6961782 |
| Molecular Formula | C20H22N5O5+ |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-(furan-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)c1cc(-c2ccco2)nn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N5O5/c26-20(21-6-7-23-8-11-29-12-9-23)18-14-17(19-5-2-10-30-19)22-24(18)15-3-1-4-16(13-15)25(27)28/h1-5,10,13-14H,6-9,11-12H2,(H,21,26)/p+1 |
| InChIKey | RFDAJQLESBXXGZ-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 116.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|