C32H28ClN3O2 — CID 3371409
N-benzyl-3-(2-chlorophenyl)-1-(4-methoxyphenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide (PubChem CID 3371409) has the molecular formula C32H28ClN3O2 and a molecular weight of 522.05 g/mol. Its IUPAC name is N-benzyl-3-(2-chlorophenyl)-1-(4-methoxyphenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide.
| Compound Name | N-benzyl-3-(2-chlorophenyl)-1-(4-methoxyphenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3371409 |
| Molecular Formula | C32H28ClN3O2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-benzyl-3-(2-chlorophenyl)-1-(4-methoxyphenyl)-N-(2-phenylethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-n2nc(-c3ccccc3Cl)cc2C(=O)N(CCc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H28ClN3O2/c1-38-27-18-16-26(17-19-27)36-31(22-30(34-36)28-14-8-9-15-29(28)33)32(37)35(23-25-12-6-3-7-13-25)21-20-24-10-4-2-5-11-24/h2-19,22H,20-21,23H2,1H3 |
| InChIKey | SZRYATRMOHOJKI-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |