C26H23N5O2 — CID 3339948
N-(2-cyanoethyl)-3-(4-methoxyphenyl)-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide (PubChem CID 3339948) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(4-methoxyphenyl)-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide.
| Compound Name | N-(2-cyanoethyl)-3-(4-methoxyphenyl)-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3339948 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-(2-cyanoethyl)-3-(4-methoxyphenyl)-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N(CCC#N)Cc3cccnc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H23N5O2/c1-33-23-12-10-21(11-13-23)24-17-25(31(29-24)22-8-3-2-4-9-22)26(32)30(16-6-14-27)19-20-7-5-15-28-18-20/h2-5,7-13,15,17-18H,6,16,19H2,1H3 |
| InChIKey | AEKKTUJBZTZVSV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |