C25H19ClN6O3 — CID 3275127
1-(2-chlorophenyl)-N-(2-cyanoethyl)-3-(4-nitrophenyl)-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide (PubChem CID 3275127) has the molecular formula C25H19ClN6O3 and a molecular weight of 486.92 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2-cyanoethyl)-3-(4-nitrophenyl)-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(2-cyanoethyl)-3-(4-nitrophenyl)-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3275127 |
| Molecular Formula | C25H19ClN6O3 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2-cyanoethyl)-3-(4-nitrophenyl)-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C25H19ClN6O3/c26-21-6-1-2-7-23(21)31-24(15-22(29-31)19-8-10-20(11-9-19)32(34)35)25(33)30(14-4-12-27)17-18-5-3-13-28-16-18/h1-3,5-11,13,15-16H,4,14,17H2 |
| InChIKey | DUWYKYMNEHGLMH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 117.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|