C22H23ClN4O3 — CID 4010733
1-(2-chlorophenyl)-3-(4-nitrophenyl)-N,N-dipropylpyrazole-5-carboxamide (PubChem CID 4010733) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(4-nitrophenyl)-N,N-dipropylpyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-3-(4-nitrophenyl)-N,N-dipropylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4010733 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(4-nitrophenyl)-N,N-dipropylpyrazole-5-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C22H23ClN4O3/c1-3-13-25(14-4-2)22(28)21-15-19(16-9-11-17(12-10-16)27(29)30)24-26(21)20-8-6-5-7-18(20)23/h5-12,15H,3-4,13-14H2,1-2H3 |
| InChIKey | GSCGAMADGMNIAH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|