C28H25Cl2N5O4 — CID 4298332
N-butyl-4-chloro-N-[2-[[1-(2-chlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 4298332) has the molecular formula C28H25Cl2N5O4 and a molecular weight of 566.45 g/mol. Its IUPAC name is N-butyl-4-chloro-N-[2-[[1-(2-chlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-butyl-4-chloro-N-[2-[[1-(2-chlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4298332 |
| Molecular Formula | C28H25Cl2N5O4 |
| Molecular Weight | 566.45 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | N-butyl-4-chloro-N-[2-[[1-(2-chlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | CCCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccccc1Cl)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H25Cl2N5O4/c1-2-3-15-33(28(37)20-13-14-22(30)25(16-20)35(38)39)18-27(36)31-26-17-23(19-9-5-4-6-10-19)32-34(26)24-12-8-7-11-21(24)29/h4-14,16-17H,2-3,15,18H2,1H3,(H,31,36) |
| InChIKey | BKHRTQOFDYSTDE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.45 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|