C27H23ClFN5O5 — CID 42736814
4-chloro-N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide (PubChem CID 42736814) has the molecular formula C27H23ClFN5O5 and a molecular weight of 551.96 g/mol. Its IUPAC name is 4-chloro-N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 42736814 |
| Molecular Formula | C27H23ClFN5O5 |
| Molecular Weight | 551.96 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 4-chloro-N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide |
| SMILES | COCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(F)cc1)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H23ClFN5O5/c1-39-14-13-32(27(36)19-7-12-22(28)24(15-19)34(37)38)17-26(35)30-25-16-23(18-5-3-2-4-6-18)31-33(25)21-10-8-20(29)9-11-21/h2-12,15-16H,13-14,17H2,1H3,(H,30,35) |
| InChIKey | BKXXZGFTZDJUFE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.96 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|