C30H31FN4O5 — CID 5175166
N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-3,5-dimethoxy-N-(3-methoxypropyl)benzamide (PubChem CID 5175166) has the molecular formula C30H31FN4O5 and a molecular weight of 546.60 g/mol. Its IUPAC name is N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-3,5-dimethoxy-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-3,5-dimethoxy-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 5175166 |
| Molecular Formula | C30H31FN4O5 |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-3,5-dimethoxy-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(F)cc1)C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C30H31FN4O5/c1-38-15-7-14-34(30(37)22-16-25(39-2)18-26(17-22)40-3)20-29(36)32-28-19-27(21-8-5-4-6-9-21)33-35(28)24-12-10-23(31)11-13-24/h4-6,8-13,16-19H,7,14-15,20H2,1-3H3,(H,32,36) |
| InChIKey | IFUVFHJGFXGRGZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|