C28H35FN4O2 — CID 3524886
N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-pentylhexanamide (PubChem CID 3524886) has the molecular formula C28H35FN4O2 and a molecular weight of 478.61 g/mol. Its IUPAC name is N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-pentylhexanamide.
| Compound Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-pentylhexanamide |
|---|---|
| PubChem CID | 3524886 |
| Molecular Formula | C28H35FN4O2 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-pentylhexanamide |
| SMILES | CCCCCC(=O)N(CCCCC)CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H35FN4O2/c1-3-5-8-14-28(35)32(19-11-6-4-2)21-27(34)30-26-20-25(22-12-9-7-10-13-22)31-33(26)24-17-15-23(29)16-18-24/h7,9-10,12-13,15-18,20H,3-6,8,11,14,19,21H2,1-2H3,(H,30,34) |
| InChIKey | DWWNNUGRIIOXNV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|