C31H33FN4O3 — CID 3380613
N-[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]-2-[pentyl-(2-phenylmethoxyacetyl)amino]acetamide (PubChem CID 3380613) has the molecular formula C31H33FN4O3 and a molecular weight of 528.63 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]-2-[pentyl-(2-phenylmethoxyacetyl)amino]acetamide.
| Compound Name | N-[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]-2-[pentyl-(2-phenylmethoxyacetyl)amino]acetamide |
|---|---|
| PubChem CID | 3380613 |
| Molecular Formula | C31H33FN4O3 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]-2-[pentyl-(2-phenylmethoxyacetyl)amino]acetamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(F)cc1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C31H33FN4O3/c1-2-3-10-19-35(31(38)23-39-22-24-11-6-4-7-12-24)21-30(37)33-29-20-28(25-13-8-5-9-14-25)34-36(29)27-17-15-26(32)16-18-27/h4-9,11-18,20H,2-3,10,19,21-23H2,1H3,(H,33,37) |
| InChIKey | MZTUWDMDPJAQRM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|