C31H42N4O3 — CID 3579116
N-butyl-N-[2-[[1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]nonanamide (PubChem CID 3579116) has the molecular formula C31H42N4O3 and a molecular weight of 518.70 g/mol. Its IUPAC name is N-butyl-N-[2-[[1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]nonanamide.
| Compound Name | N-butyl-N-[2-[[1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]nonanamide |
|---|---|
| PubChem CID | 3579116 |
| Molecular Formula | C31H42N4O3 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | N-butyl-N-[2-[[1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCC)CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H42N4O3/c1-4-6-8-9-10-14-17-31(37)34(22-7-5-2)24-30(36)32-29-23-28(25-15-12-11-13-16-25)33-35(29)26-18-20-27(38-3)21-19-26/h11-13,15-16,18-21,23H,4-10,14,17,22,24H2,1-3H3,(H,32,36) |
| InChIKey | RSFVVKHDMCBCSB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|