C26H40N4O4 — CID 5136422
N-[2-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)heptanamide (PubChem CID 5136422) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)heptanamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)heptanamide |
|---|---|
| PubChem CID | 5136422 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)heptanamide |
| SMILES | CCCCCCC(=O)N(CCOC)CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H40N4O4/c1-7-8-9-10-11-25(32)29(16-17-33-5)19-24(31)27-23-18-22(26(2,3)4)28-30(23)20-12-14-21(34-6)15-13-20/h12-15,18H,7-11,16-17,19H2,1-6H3,(H,27,31) |
| InChIKey | IJCGEACILRBLDO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|