C29H46N4O3 — CID 4570795
N-[2-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-yldecanamide (PubChem CID 4570795) has the molecular formula C29H46N4O3 and a molecular weight of 498.71 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-yldecanamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-yldecanamide |
|---|---|
| PubChem CID | 4570795 |
| Molecular Formula | C29H46N4O3 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-yldecanamide |
| SMILES | CCCCCCCCCC(=O)N(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(OC)cc1)C(C)C |
| InChI | InChI=1S/C29H46N4O3/c1-8-9-10-11-12-13-14-15-28(35)32(22(2)3)21-27(34)30-26-20-25(29(4,5)6)31-33(26)23-16-18-24(36-7)19-17-23/h16-20,22H,8-15,21H2,1-7H3,(H,30,34) |
| InChIKey | CNMDNAQNFGACBO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|