C25H38N4O2 — CID 42733287
N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-ylhexanamide (PubChem CID 42733287) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-ylhexanamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 42733287 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-propan-2-ylhexanamide |
| SMILES | CCCCCC(=O)N(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C25H38N4O2/c1-8-9-10-11-24(31)28(18(2)3)17-23(30)26-22-16-21(25(5,6)7)27-29(22)20-14-12-19(4)13-15-20/h12-16,18H,8-11,17H2,1-7H3,(H,26,30) |
| InChIKey | YFTOWXACAOPFDU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|