C28H44N4O2 — CID 4214119
N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methylpropyl)octanamide (PubChem CID 4214119) has the molecular formula C28H44N4O2 and a molecular weight of 468.69 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methylpropyl)octanamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methylpropyl)octanamide |
|---|---|
| PubChem CID | 4214119 |
| Molecular Formula | C28H44N4O2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methylpropyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(C)cc1)CC(C)C |
| InChI | InChI=1S/C28H44N4O2/c1-8-9-10-11-12-13-27(34)31(19-21(2)3)20-26(33)29-25-18-24(28(5,6)7)30-32(25)23-16-14-22(4)15-17-23/h14-18,21H,8-13,19-20H2,1-7H3,(H,29,33) |
| InChIKey | JMQYCFUQRMETKQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|